C24H27BF2N2O4 — CID 69290673
(2S)-N-[(4-cyanophenyl)methyl]-2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-ethoxyacetamide (PubChem CID 69290673) has the molecular formula C24H27BF2N2O4 and a molecular weight of 456.30 g/mol. Its IUPAC name is (2S)-N-[(4-cyanophenyl)methyl]-2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-ethoxyacetamide.
| Compound Name | (2S)-N-[(4-cyanophenyl)methyl]-2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 69290673 |
| Molecular Formula | C24H27BF2N2O4 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | (2S)-N-[(4-cyanophenyl)methyl]-2-[2,6-difluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-2-ethoxyacetamide |
| SMILES | CCO[C@H](C(=O)NCc1ccc(C#N)cc1)c1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1F |
| InChI | InChI=1S/C24H27BF2N2O4/c1-6-31-21(22(30)29-14-16-9-7-15(13-28)8-10-16)20-18(26)11-17(12-19(20)27)25-32-23(2,3)24(4,5)33-25/h7-12,21H,6,14H2,1-5H3,(H,29,30)/t21-/m0/s1 |
| InChIKey | HBIFBULBJOGHME-NRFANRHFSA-N |
| XLogP | 3.53 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|