C32H27Cl2F3N4O3 — CID 69292426
3,5-dichloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]benzamide;N-(trifluoromethyl)benzamide (PubChem CID 69292426) has the molecular formula C32H27Cl2F3N4O3 and a molecular weight of 643.49 g/mol. Its IUPAC name is 3,5-dichloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]benzamide;N-(trifluoromethyl)benzamide.
| Compound Name | 3,5-dichloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]benzamide;N-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69292426 |
| Molecular Formula | C32H27Cl2F3N4O3 |
| Molecular Weight | 643.49 g/mol |
| Exact Mass | 642.14 |
| IUPAC Name | 3,5-dichloro-N-[2-[4-(diethylamino)phenyl]-1,3-benzoxazol-5-yl]benzamide;N-(trifluoromethyl)benzamide |
| SMILES | CCN(CC)c1ccc(-c2nc3cc(NC(=O)c4cc(Cl)cc(Cl)c4)ccc3o2)cc1.O=C(NC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C24H21Cl2N3O2.C8H6F3NO/c1-3-29(4-2)20-8-5-15(6-9-20)24-28-21-14-19(7-10-22(21)31-24)27-23(30)16-11-17(25)13-18(26)12-16;9-8(10,11)12-7(13)6-4-2-1-3-5-6/h5-14H,3-4H2,1-2H3,(H,27,30);1-5H,(H,12,13) |
| InChIKey | ULEPTILZZNVTHM-UHFFFAOYSA-N |
| XLogP | 8.84 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.49 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|