C30H52N4O8S — CID 69302252
[2-[[4-(butoxycarbonylamino)phenyl]sulfonyl-(2-methylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] 2-(dimethylamino)acetate (PubChem CID 69302252) has the molecular formula C30H52N4O8S and a molecular weight of 628.83 g/mol. Its IUPAC name is [2-[[4-(butoxycarbonylamino)phenyl]sulfonyl-(2-methylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] 2-(dimethylamino)acetate.
| Compound Name | [2-[[4-(butoxycarbonylamino)phenyl]sulfonyl-(2-methylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] 2-(dimethylamino)acetate |
|---|---|
| PubChem CID | 69302252 |
| Molecular Formula | C30H52N4O8S |
| Molecular Weight | 628.83 g/mol |
| Exact Mass | 628.35 |
| IUPAC Name | [2-[[4-(butoxycarbonylamino)phenyl]sulfonyl-(2-methylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl] 2-(dimethylamino)acetate |
| SMILES | CCCCOC(=O)Nc1ccc(S(=O)(=O)N(CC(C)C)C(CCCCNC(=O)OC(C)(C)C)COC(=O)CN(C)C)cc1 |
| InChI | InChI=1S/C30H52N4O8S/c1-9-10-19-40-29(37)32-24-14-16-26(17-15-24)43(38,39)34(20-23(2)3)25(22-41-27(35)21-33(7)8)13-11-12-18-31-28(36)42-30(4,5)6/h14-17,23,25H,9-13,18-22H2,1-8H3,(H,31,36)(H,32,37) |
| InChIKey | SABMRBUMZLNYME-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.83 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|