C16H31O3P — CID 69302484
(1,1-dicyclohexyl-2-methylpropan-2-yl) dihydrogen phosphite (PubChem CID 69302484) has the molecular formula C16H31O3P and a molecular weight of 302.39 g/mol. Its IUPAC name is (1,1-dicyclohexyl-2-methylpropan-2-yl) dihydrogen phosphite.
| Compound Name | (1,1-dicyclohexyl-2-methylpropan-2-yl) dihydrogen phosphite |
|---|---|
| PubChem CID | 69302484 |
| Molecular Formula | C16H31O3P |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (1,1-dicyclohexyl-2-methylpropan-2-yl) dihydrogen phosphite |
| SMILES | CC(C)(OP(O)O)C(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H31O3P/c1-16(2,19-20(17)18)15(13-9-5-3-6-10-13)14-11-7-4-8-12-14/h13-15,17-18H,3-12H2,1-2H3 |
| InChIKey | FGKYCIPIESNIMG-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|