C33H35NO4S — CID 69304952
4-[2-phenyl-4-[4-[5-(pyridin-2-ylmethylsulfonyl)pentoxy]phenyl]but-1-enyl]phenol (PubChem CID 69304952) has the molecular formula C33H35NO4S and a molecular weight of 541.71 g/mol. Its IUPAC name is 4-[2-phenyl-4-[4-[5-(pyridin-2-ylmethylsulfonyl)pentoxy]phenyl]but-1-enyl]phenol.
| Compound Name | 4-[2-phenyl-4-[4-[5-(pyridin-2-ylmethylsulfonyl)pentoxy]phenyl]but-1-enyl]phenol |
|---|---|
| PubChem CID | 69304952 |
| Molecular Formula | C33H35NO4S |
| Molecular Weight | 541.71 g/mol |
| Exact Mass | 541.23 |
| IUPAC Name | 4-[2-phenyl-4-[4-[5-(pyridin-2-ylmethylsulfonyl)pentoxy]phenyl]but-1-enyl]phenol |
| SMILES | O=S(=O)(CCCCCOc1ccc(CCC(=Cc2ccc(O)cc2)c2ccccc2)cc1)Cc1ccccn1 |
| InChI | InChI=1S/C33H35NO4S/c35-32-18-13-28(14-19-32)25-30(29-9-3-1-4-10-29)17-12-27-15-20-33(21-16-27)38-23-7-2-8-24-39(36,37)26-31-11-5-6-22-34-31/h1,3-6,9-11,13-16,18-22,25,35H,2,7-8,12,17,23-24,26H2 |
| InChIKey | WKRBJEMHUSMWHB-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|