C33H35NO3S — CID 67649237
2-[5-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]pentylsulfonylmethyl]pyridine (PubChem CID 67649237) has the molecular formula C33H35NO3S and a molecular weight of 525.71 g/mol. Its IUPAC name is 2-[5-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]pentylsulfonylmethyl]pyridine.
| Compound Name | 2-[5-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]pentylsulfonylmethyl]pyridine |
|---|---|
| PubChem CID | 67649237 |
| Molecular Formula | C33H35NO3S |
| Molecular Weight | 525.71 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 2-[5-[4-[(Z)-1,2-diphenylbut-1-enyl]phenoxy]pentylsulfonylmethyl]pyridine |
| SMILES | CC/C(=C(\c1ccccc1)c1ccc(OCCCCCS(=O)(=O)Cc2ccccn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H35NO3S/c1-2-32(27-14-6-3-7-15-27)33(28-16-8-4-9-17-28)29-19-21-31(22-20-29)37-24-12-5-13-25-38(35,36)26-30-18-10-11-23-34-30/h3-4,6-11,14-23H,2,5,12-13,24-26H2,1H3/b33-32- |
| InChIKey | BUFYDJLQMPAXNX-KARKAFJISA-N |
| XLogP | 7.61 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.71 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|