C13H13N5 — CID 69327873
1-(3-aminoprop-2-enyl)imidazo[4,5-c]quinolin-4-amine (PubChem CID 69327873) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 1-(3-aminoprop-2-enyl)imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-(3-aminoprop-2-enyl)imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 69327873 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-(3-aminoprop-2-enyl)imidazo[4,5-c]quinolin-4-amine |
| SMILES | NC=CCn1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C13H13N5/c14-6-3-7-18-8-16-11-12(18)9-4-1-2-5-10(9)17-13(11)15/h1-6,8H,7,14H2,(H2,15,17) |
| InChIKey | GGVJWYYRONIMJN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |