C18H23N5O — CID 58869100
1-[(4E)-4-methoxyimino-2,2-dimethylpentyl]imidazo[4,5-c]quinolin-4-amine (PubChem CID 58869100) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-[(4E)-4-methoxyimino-2,2-dimethylpentyl]imidazo[4,5-c]quinolin-4-amine.
| Compound Name | 1-[(4E)-4-methoxyimino-2,2-dimethylpentyl]imidazo[4,5-c]quinolin-4-amine |
|---|---|
| PubChem CID | 58869100 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-[(4E)-4-methoxyimino-2,2-dimethylpentyl]imidazo[4,5-c]quinolin-4-amine |
| SMILES | CO/N=C(\C)CC(C)(C)Cn1cnc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C18H23N5O/c1-12(22-24-4)9-18(2,3)10-23-11-20-15-16(23)13-7-5-6-8-14(13)21-17(15)19/h5-8,11H,9-10H2,1-4H3,(H2,19,21)/b22-12+ |
| InChIKey | SVMIVASCMFZNTF-WSDLNYQXSA-N |
| XLogP | 3.61 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|