About [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol
[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol (PubChem CID 69338089) has the molecular formula C20H19BN2O3
and a molecular weight of 346.20 g/mol. Its IUPAC name is [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol.
Molecular Properties
| Compound Name | [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol |
| PubChem CID | 69338089 |
| Molecular Formula | C20H19BN2O3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol |
| SMILES | C=CB(O)c1ccc(C2=NCCO2)cc1.Oc1cccc2cccnc12 |
| InChI | InChI=1S/C11H12BNO2.C9H7NO/c1-2-12(14)10-5-3-9(4-6-10)11-13-7-8-15-11;11-8-5-1-3-7-4-2-6-10-9(7)8/h2-6,14H,1,7-8H2;1-6,11H |
| InChIKey | QQCVZJSEHLGOBC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol?
The IUPAC name of [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol (CID 69338089) is [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol.
What is the SMILES notation for [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol?
The canonical SMILES for [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol is C=CB(O)c1ccc(C2=NCCO2)cc1.Oc1cccc2cccnc12.
What is the InChIKey of [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol?
The InChIKey is QQCVZJSEHLGOBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12BNO2.C9H7NO/c1-2-12(14)10-5-3-9(4-6-10)11-13-7-8-15-11;11-8-5-1-3-7-4-2-6-10-9(7)8/h2-6,14H,1,7-8H2;1-6,11H.
What are the key properties of [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol?
[4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol has a molecular weight of 346.20 g/mol, XLogP of 2.32, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]-ethenylborinic acid;quinolin-8-ol is sourced from PubChem (CID 69338089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).