C22H32ClFN2O6 — CID 69341696
tert-butyl 3-[[(2R)-2-chloro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-5-fluoro-4-hydroxypentanoate (PubChem CID 69341696) has the molecular formula C22H32ClFN2O6 and a molecular weight of 474.96 g/mol. Its IUPAC name is tert-butyl 3-[[(2R)-2-chloro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-5-fluoro-4-hydroxypentanoate.
| Compound Name | tert-butyl 3-[[(2R)-2-chloro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-5-fluoro-4-hydroxypentanoate |
|---|---|
| PubChem CID | 69341696 |
| Molecular Formula | C22H32ClFN2O6 |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | tert-butyl 3-[[(2R)-2-chloro-3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]-5-fluoro-4-hydroxypentanoate |
| SMILES | CC(C)[C@](Cl)(NC(=O)OCc1ccccc1)C(=O)NC(CC(=O)OC(C)(C)C)C(O)CF |
| InChI | InChI=1S/C22H32ClFN2O6/c1-14(2)22(23,26-20(30)31-13-15-9-7-6-8-10-15)19(29)25-16(17(27)12-24)11-18(28)32-21(3,4)5/h6-10,14,16-17,27H,11-13H2,1-5H3,(H,25,29)(H,26,30)/t16?,17?,22-/m0/s1 |
| InChIKey | YZWDPOZCOVDKIJ-XWTGJVNOSA-N |
| XLogP | 3.05 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|