C30H41N3O7 — CID 69344506
[5-[(1R)-2-[6-[4-[2-(2,5-dioxoimidazolidin-1-yl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate (PubChem CID 69344506) has the molecular formula C30H41N3O7 and a molecular weight of 555.67 g/mol. Its IUPAC name is [5-[(1R)-2-[6-[4-[2-(2,5-dioxoimidazolidin-1-yl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate.
| Compound Name | [5-[(1R)-2-[6-[4-[2-(2,5-dioxoimidazolidin-1-yl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate |
|---|---|
| PubChem CID | 69344506 |
| Molecular Formula | C30H41N3O7 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | [5-[(1R)-2-[6-[4-[2-(2,5-dioxoimidazolidin-1-yl)phenyl]butoxy]hexylamino]-1-hydroxyethyl]-2-hydroxyphenyl]methyl acetate |
| SMILES | CC(=O)OCc1cc([C@@H](O)CNCCCCCCOCCCCc2ccccc2N2C(=O)CNC2=O)ccc1O |
| InChI | InChI=1S/C30H41N3O7/c1-22(34)40-21-25-18-24(13-14-27(25)35)28(36)19-31-15-7-2-3-8-16-39-17-9-6-11-23-10-4-5-12-26(23)33-29(37)20-32-30(33)38/h4-5,10,12-14,18,28,31,35-36H,2-3,6-9,11,15-17,19-21H2,1H3,(H,32,38)/t28-/m0/s1 |
| InChIKey | QAUSJIGKTIZTDS-NDEPHWFRSA-N |
| XLogP | 3.73 |
| TPSA | 137.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|