C11H15NO4 — CID 69347522
1,3-dimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxylic acid (PubChem CID 69347522) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 1,3-dimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxylic acid.
| Compound Name | 1,3-dimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxylic acid |
|---|---|
| PubChem CID | 69347522 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1,3-dimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxylic acid |
| SMILES | CN1C(=O)C2CC(C(=O)O)CC(C)(C2)C1=O |
| InChI | InChI=1S/C11H15NO4/c1-11-4-6(3-7(5-11)9(14)15)8(13)12(2)10(11)16/h6-7H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | JIZRZTLCDTVTFL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|