C12H13ClN4O3 — CID 69359067
methyl 7-(4-chlorobutanoylamino)-2H-benzotriazole-5-carboxylate (PubChem CID 69359067) has the molecular formula C12H13ClN4O3 and a molecular weight of 296.71 g/mol. Its IUPAC name is methyl 7-(4-chlorobutanoylamino)-2H-benzotriazole-5-carboxylate.
| Compound Name | methyl 7-(4-chlorobutanoylamino)-2H-benzotriazole-5-carboxylate |
|---|---|
| PubChem CID | 69359067 |
| Molecular Formula | C12H13ClN4O3 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | methyl 7-(4-chlorobutanoylamino)-2H-benzotriazole-5-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)CCCCl)c2n[nH]nc2c1 |
| InChI | InChI=1S/C12H13ClN4O3/c1-20-12(19)7-5-8(14-10(18)3-2-4-13)11-9(6-7)15-17-16-11/h5-6H,2-4H2,1H3,(H,14,18)(H,15,16,17) |
| InChIKey | BVAFWUSBMURRDS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|