C48H57NO8S — CID 69362602
6-prop-2-enoyloxyhexyl 6-[5-[4-[bis(6-prop-2-enoyloxyhexyl)amino]phenyl]thiophen-2-yl]naphthalene-2-carboxylate (PubChem CID 69362602) has the molecular formula C48H57NO8S and a molecular weight of 808.05 g/mol. Its IUPAC name is 6-prop-2-enoyloxyhexyl 6-[5-[4-[bis(6-prop-2-enoyloxyhexyl)amino]phenyl]thiophen-2-yl]naphthalene-2-carboxylate.
| Compound Name | 6-prop-2-enoyloxyhexyl 6-[5-[4-[bis(6-prop-2-enoyloxyhexyl)amino]phenyl]thiophen-2-yl]naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 69362602 |
| Molecular Formula | C48H57NO8S |
| Molecular Weight | 808.05 g/mol |
| Exact Mass | 807.38 |
| IUPAC Name | 6-prop-2-enoyloxyhexyl 6-[5-[4-[bis(6-prop-2-enoyloxyhexyl)amino]phenyl]thiophen-2-yl]naphthalene-2-carboxylate |
| SMILES | C=CC(=O)OCCCCCCOC(=O)c1ccc2cc(-c3ccc(-c4ccc(N(CCCCCCOC(=O)C=C)CCCCCCOC(=O)C=C)cc4)s3)ccc2c1 |
| InChI | InChI=1S/C48H57NO8S/c1-4-45(50)54-31-15-9-7-13-29-49(30-14-8-10-16-32-55-46(51)5-2)42-25-23-37(24-26-42)43-27-28-44(58-43)40-21-19-39-36-41(22-20-38(39)35-40)48(53)57-34-18-12-11-17-33-56-47(52)6-3/h4-6,19-28,35-36H,1-3,7-18,29-34H2 |
| InChIKey | XJEWRTGVEKPLJO-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.05 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|