C23H25Cl2N3O2S — CID 69363621
3-[3-[5-(2,6-dichloro-4-methylsulfanylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide (PubChem CID 69363621) has the molecular formula C23H25Cl2N3O2S and a molecular weight of 478.45 g/mol. Its IUPAC name is 3-[3-[5-(2,6-dichloro-4-methylsulfanylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide.
| Compound Name | 3-[3-[5-(2,6-dichloro-4-methylsulfanylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 69363621 |
| Molecular Formula | C23H25Cl2N3O2S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 3-[3-[5-(2,6-dichloro-4-methylsulfanylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide |
| SMILES | CSc1cc(Cl)c(C(=O)N2CC3CN(c4cccc(CCC(N)=O)c4)CC3C2)c(Cl)c1 |
| InChI | InChI=1S/C23H25Cl2N3O2S/c1-31-18-8-19(24)22(20(25)9-18)23(30)28-12-15-10-27(11-16(15)13-28)17-4-2-3-14(7-17)5-6-21(26)29/h2-4,7-9,15-16H,5-6,10-13H2,1H3,(H2,26,29) |
| InChIKey | NIPVUTDWNPLJFU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |