C31H42N4O2 — CID 69365988
N-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2-piperidin-1-ylacetamide (PubChem CID 69365988) has the molecular formula C31H42N4O2 and a molecular weight of 502.70 g/mol. Its IUPAC name is N-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2-piperidin-1-ylacetamide.
| Compound Name | N-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2-piperidin-1-ylacetamide |
|---|---|
| PubChem CID | 69365988 |
| Molecular Formula | C31H42N4O2 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | N-[3-[3-[5-(2,6-dimethylbenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2-piperidin-1-ylacetamide |
| SMILES | Cc1cccc(C)c1C(=O)N1CC2CN(c3cccc(CCCNC(=O)CN4CCCCC4)c3)CC2C1 |
| InChI | InChI=1S/C31H42N4O2/c1-23-9-6-10-24(2)30(23)31(37)35-20-26-18-34(19-27(26)21-35)28-13-7-11-25(17-28)12-8-14-32-29(36)22-33-15-4-3-5-16-33/h6-7,9-11,13,17,26-27H,3-5,8,12,14-16,18-22H2,1-2H3,(H,32,36) |
| InChIKey | QENYBOMAJLOBGX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|