C23H28N4O2 — CID 69366093
3-[3-[5-[4-(methylamino)benzoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide (PubChem CID 69366093) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-[3-[5-[4-(methylamino)benzoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide.
| Compound Name | 3-[3-[5-[4-(methylamino)benzoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 69366093 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-[3-[5-[4-(methylamino)benzoyl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propanamide |
| SMILES | CNc1ccc(C(=O)N2CC3CN(c4cccc(CCC(N)=O)c4)CC3C2)cc1 |
| InChI | InChI=1S/C23H28N4O2/c1-25-20-8-6-17(7-9-20)23(29)27-14-18-12-26(13-19(18)15-27)21-4-2-3-16(11-21)5-10-22(24)28/h2-4,6-9,11,18-19,25H,5,10,12-15H2,1H3,(H2,24,28) |
| InChIKey | XIIOZMXIYSULFT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |