C29H27ClF3N3O2 — CID 69364900
N-[3-[3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2,4-difluorobenzamide (PubChem CID 69364900) has the molecular formula C29H27ClF3N3O2 and a molecular weight of 542.00 g/mol. Its IUPAC name is N-[3-[3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2,4-difluorobenzamide.
| Compound Name | N-[3-[3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 69364900 |
| Molecular Formula | C29H27ClF3N3O2 |
| Molecular Weight | 542.00 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | N-[3-[3-[5-(2-chloro-6-fluorobenzoyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl]phenyl]propyl]-2,4-difluorobenzamide |
| SMILES | O=C(NCCCc1cccc(N2CC3CN(C(=O)c4c(F)cccc4Cl)CC3C2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C29H27ClF3N3O2/c30-24-7-2-8-25(32)27(24)29(38)36-16-19-14-35(15-20(19)17-36)22-6-1-4-18(12-22)5-3-11-34-28(37)23-10-9-21(31)13-26(23)33/h1-2,4,6-10,12-13,19-20H,3,5,11,14-17H2,(H,34,37) |
| InChIKey | JFYPCQWUBQPFRN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.00 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|