C20H26N8O3 — CID 69368504
(3R)-1-[1-(2-ethoxyethyl)-3-methyl-7-(pyrimidin-4-ylamino)pyrazolo[4,5-d]pyrimidin-5-yl]piperidine-3-carboxylic acid (PubChem CID 69368504) has the molecular formula C20H26N8O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is (3R)-1-[1-(2-ethoxyethyl)-3-methyl-7-(pyrimidin-4-ylamino)pyrazolo[4,5-d]pyrimidin-5-yl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[1-(2-ethoxyethyl)-3-methyl-7-(pyrimidin-4-ylamino)pyrazolo[4,5-d]pyrimidin-5-yl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69368504 |
| Molecular Formula | C20H26N8O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | (3R)-1-[1-(2-ethoxyethyl)-3-methyl-7-(pyrimidin-4-ylamino)pyrazolo[4,5-d]pyrimidin-5-yl]piperidine-3-carboxylic acid |
| SMILES | CCOCCn1nc(C)c2nc(N3CCC[C@@H](C(=O)O)C3)nc(Nc3ccncn3)c21 |
| InChI | InChI=1S/C20H26N8O3/c1-3-31-10-9-28-17-16(13(2)26-28)24-20(27-8-4-5-14(11-27)19(29)30)25-18(17)23-15-6-7-21-12-22-15/h6-7,12,14H,3-5,8-11H2,1-2H3,(H,29,30)(H,21,22,23,24,25)/t14-/m1/s1 |
| InChIKey | MHBSPPKZNIWRQH-CQSZACIVSA-N |
| XLogP | 2.01 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|