C22H35N9O — CID 143455026
ethane;1-(2-ethoxyethyl)-3-ethyl-5-(3-methylpiperazin-1-yl)-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 143455026) has the molecular formula C22H35N9O and a molecular weight of 441.58 g/mol. Its IUPAC name is ethane;1-(2-ethoxyethyl)-3-ethyl-5-(3-methylpiperazin-1-yl)-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | ethane;1-(2-ethoxyethyl)-3-ethyl-5-(3-methylpiperazin-1-yl)-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 143455026 |
| Molecular Formula | C22H35N9O |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.30 |
| IUPAC Name | ethane;1-(2-ethoxyethyl)-3-ethyl-5-(3-methylpiperazin-1-yl)-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CC.CCOCCn1nc(CC)c2nc(N3CCNC(C)C3)nc(Nc3ccncn3)c21 |
| InChI | InChI=1S/C20H29N9O.C2H6/c1-4-15-17-18(29(27-15)10-11-30-5-2)19(24-16-6-7-21-13-23-16)26-20(25-17)28-9-8-22-14(3)12-28;1-2/h6-7,13-14,22H,4-5,8-12H2,1-3H3,(H,21,23,24,25,26);1-2H3 |
| InChIKey | VQVVCOFUASYRNK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|