C20H29N9O2 — CID 70323708
1-(2-ethoxyethyl)-3-(2-methoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 70323708) has the molecular formula C20H29N9O2 and a molecular weight of 427.51 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-(2-methoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1-(2-ethoxyethyl)-3-(2-methoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 70323708 |
| Molecular Formula | C20H29N9O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-(2-methoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1nc(CCOC)c2nc(N3CCNCC3)nc(Nc3ccncn3)c21 |
| InChI | InChI=1S/C20H29N9O2/c1-3-31-13-11-29-18-17(15(27-29)5-12-30-2)25-20(28-9-7-21-8-10-28)26-19(18)24-16-4-6-22-14-23-16/h4,6,14,21H,3,5,7-13H2,1-2H3,(H,22,23,24,25,26) |
| InChIKey | LGDGPOPLCGABMM-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|