C17H23N9O — CID 69368950
1-(2-ethoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 69368950) has the molecular formula C17H23N9O and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1-(2-ethoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69368950 |
| Molecular Formula | C17H23N9O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-(2-ethoxyethyl)-5-piperazin-1-yl-N-pyrimidin-4-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1ncc2nc(N3CCNCC3)nc(Nc3ccncn3)c21 |
| InChI | InChI=1S/C17H23N9O/c1-2-27-10-9-26-15-13(11-21-26)22-17(25-7-5-18-6-8-25)24-16(15)23-14-3-4-19-12-20-14/h3-4,11-12,18H,2,5-10H2,1H3,(H,19,20,22,23,24) |
| InChIKey | IENLLMKMPRWGDL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|