C18H22F3N9O — CID 69370851
5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 69370851) has the molecular formula C18H22F3N9O and a molecular weight of 437.43 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69370851 |
| Molecular Formula | C18H22F3N9O |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | FC(F)(F)COCCn1ncc2nc(N3CCCNCC3)nc(Nc3ccncn3)c21 |
| InChI | InChI=1S/C18H22F3N9O/c19-18(20,21)11-31-9-8-30-15-13(10-25-30)26-17(29-6-1-3-22-5-7-29)28-16(15)27-14-2-4-23-12-24-14/h2,4,10,12,22H,1,3,5-9,11H2,(H,23,24,26,27,28) |
| InChIKey | OKBMPJDMIGKHCZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|