C19H26N8O — CID 69369444
1-(2-ethoxyethyl)-N-(5-methyl-2-pyridinyl)-5-piperazin-1-ylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 69369444) has the molecular formula C19H26N8O and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-N-(5-methyl-2-pyridinyl)-5-piperazin-1-ylpyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 1-(2-ethoxyethyl)-N-(5-methyl-2-pyridinyl)-5-piperazin-1-ylpyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 69369444 |
| Molecular Formula | C19H26N8O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 1-(2-ethoxyethyl)-N-(5-methyl-2-pyridinyl)-5-piperazin-1-ylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1ncc2nc(N3CCNCC3)nc(Nc3ccc(C)cn3)c21 |
| InChI | InChI=1S/C19H26N8O/c1-3-28-11-10-27-17-15(13-22-27)23-19(26-8-6-20-7-9-26)25-18(17)24-16-5-4-14(2)12-21-16/h4-5,12-13,20H,3,6-11H2,1-2H3,(H,21,23,24,25) |
| InChIKey | VYSVLXFULXCQIO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|