C17H17N3O3 — CID 6936875
(3S,4S)-3-(2-hydroxyphenyl)-N-(3-methylphenyl)-5-oxopyrazolidine-4-carboxamide (PubChem CID 6936875) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (3S,4S)-3-(2-hydroxyphenyl)-N-(3-methylphenyl)-5-oxopyrazolidine-4-carboxamide.
| Compound Name | (3S,4S)-3-(2-hydroxyphenyl)-N-(3-methylphenyl)-5-oxopyrazolidine-4-carboxamide |
|---|---|
| PubChem CID | 6936875 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (3S,4S)-3-(2-hydroxyphenyl)-N-(3-methylphenyl)-5-oxopyrazolidine-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@H]2C(=O)NN[C@@H]2c2ccccc2O)c1 |
| InChI | InChI=1S/C17H17N3O3/c1-10-5-4-6-11(9-10)18-16(22)14-15(19-20-17(14)23)12-7-2-3-8-13(12)21/h2-9,14-15,19,21H,1H3,(H,18,22)(H,20,23)/t14-,15+/m0/s1 |
| InChIKey | FQUFGSBBJUKVRW-LSDHHAIUSA-N |
| XLogP | 1.63 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|