C23H23N7O — CID 69370395
3-[5-(2,3-dimethylphenyl)pyrazin-2-yl]-12-methoxy-8-methyl-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene (PubChem CID 69370395) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is 3-[5-(2,3-dimethylphenyl)pyrazin-2-yl]-12-methoxy-8-methyl-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene.
| Compound Name | 3-[5-(2,3-dimethylphenyl)pyrazin-2-yl]-12-methoxy-8-methyl-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene |
|---|---|
| PubChem CID | 69370395 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 3-[5-(2,3-dimethylphenyl)pyrazin-2-yl]-12-methoxy-8-methyl-2,4,5,8,11-pentazatricyclo[8.4.0.02,6]tetradeca-1(10),3,5,11,13-pentaene |
| SMILES | COc1ccc2c(n1)CN(C)Cc1nnc(-c3cnc(-c4cccc(C)c4C)cn3)n1-2 |
| InChI | InChI=1S/C23H23N7O/c1-14-6-5-7-16(15(14)2)17-10-25-18(11-24-17)23-28-27-21-13-29(3)12-19-20(30(21)23)8-9-22(26-19)31-4/h5-11H,12-13H2,1-4H3 |
| InChIKey | PWFNRPICYFXIBS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |