C10H8FNO2 — CID 69375022
6-ethenyl-8-fluoro-4H-1,4-benzoxazin-3-one (PubChem CID 69375022) has the molecular formula C10H8FNO2 and a molecular weight of 193.18 g/mol. Its IUPAC name is 6-ethenyl-8-fluoro-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-ethenyl-8-fluoro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 69375022 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 6-ethenyl-8-fluoro-4H-1,4-benzoxazin-3-one |
| SMILES | C=Cc1cc(F)c2c(c1)NC(=O)CO2 |
| InChI | InChI=1S/C10H8FNO2/c1-2-6-3-7(11)10-8(4-6)12-9(13)5-14-10/h2-4H,1,5H2,(H,12,13) |
| InChIKey | USGHUYLOTYBQGN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |