C13H18Cl2NO+ — CID 6937797
(2S,6S)-4-[(2,4-dichlorophenyl)methyl]-2,6-dimethylmorpholin-4-ium (PubChem CID 6937797) has the molecular formula C13H18Cl2NO+ and a molecular weight of 275.20 g/mol. Its IUPAC name is (2S,6S)-4-[(2,4-dichlorophenyl)methyl]-2,6-dimethylmorpholin-4-ium.
| Compound Name | (2S,6S)-4-[(2,4-dichlorophenyl)methyl]-2,6-dimethylmorpholin-4-ium |
|---|---|
| PubChem CID | 6937797 |
| Molecular Formula | C13H18Cl2NO+ |
| Molecular Weight | 275.20 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (2S,6S)-4-[(2,4-dichlorophenyl)methyl]-2,6-dimethylmorpholin-4-ium |
| SMILES | C[C@H]1C[NH+](Cc2ccc(Cl)cc2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C13H17Cl2NO/c1-9-6-16(7-10(2)17-9)8-11-3-4-12(14)5-13(11)15/h3-5,9-10H,6-8H2,1-2H3/p+1/t9-,10-/m0/s1 |
| InChIKey | FAIAGMVQEOPUTH-UWVGGRQHSA-O |
| XLogP | 2.19 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |