C11H17N3S — CID 69378769
2-(2,6-diazabicyclo[3.2.2]nonan-2-ylmethyl)-1,3-thiazole (PubChem CID 69378769) has the molecular formula C11H17N3S and a molecular weight of 223.34 g/mol. Its IUPAC name is 2-(2,6-diazabicyclo[3.2.2]nonan-2-ylmethyl)-1,3-thiazole.
| Compound Name | 2-(2,6-diazabicyclo[3.2.2]nonan-2-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 69378769 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2-(2,6-diazabicyclo[3.2.2]nonan-2-ylmethyl)-1,3-thiazole |
| SMILES | c1csc(CN2CCC3CCC2CN3)n1 |
| InChI | InChI=1S/C11H17N3S/c1-2-10-7-13-9(1)3-5-14(10)8-11-12-4-6-15-11/h4,6,9-10,13H,1-3,5,7-8H2 |
| InChIKey | WQRLWRCQYUMYKL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |