About indol-2-one;oxalic acid
indol-2-one;oxalic acid (PubChem CID 69382661) has the molecular formula C10H7NO5
and a molecular weight of 221.17 g/mol. Its IUPAC name is indol-2-one;oxalic acid.
Molecular Properties
| Compound Name | indol-2-one;oxalic acid |
| PubChem CID | 69382661 |
| Molecular Formula | C10H7NO5 |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | indol-2-one;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C1C=c2ccccc2=N1 |
| InChI | InChI=1S/C8H5NO.C2H2O4/c10-8-5-6-3-1-2-4-7(6)9-8;3-1(4)2(5)6/h1-5H;(H,3,4)(H,5,6) |
| InChIKey | MKQHSAVJDZRNFH-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze indol-2-one;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indol-2-one;oxalic acid?
The IUPAC name of indol-2-one;oxalic acid (CID 69382661) is indol-2-one;oxalic acid.
What is the SMILES notation for indol-2-one;oxalic acid?
The canonical SMILES for indol-2-one;oxalic acid is O=C(O)C(=O)O.O=C1C=c2ccccc2=N1.
What is the InChIKey of indol-2-one;oxalic acid?
The InChIKey is MKQHSAVJDZRNFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO.C2H2O4/c10-8-5-6-3-1-2-4-7(6)9-8;3-1(4)2(5)6/h1-5H;(H,3,4)(H,5,6).
What are the key properties of indol-2-one;oxalic acid?
indol-2-one;oxalic acid has a molecular weight of 221.17 g/mol, XLogP of -1.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for indol-2-one;oxalic acid is sourced from PubChem (CID 69382661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).