C33H37NO7 — CID 69387399
[3-[4-[4-[2-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]ethyl]phenoxy]butyl]phenyl] acetate (PubChem CID 69387399) has the molecular formula C33H37NO7 and a molecular weight of 559.66 g/mol. Its IUPAC name is [3-[4-[4-[2-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]ethyl]phenoxy]butyl]phenyl] acetate.
| Compound Name | [3-[4-[4-[2-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]ethyl]phenoxy]butyl]phenyl] acetate |
|---|---|
| PubChem CID | 69387399 |
| Molecular Formula | C33H37NO7 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.26 |
| IUPAC Name | [3-[4-[4-[2-[(5R)-5-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)-2-oxo-1,3-oxazolidin-3-yl]ethyl]phenoxy]butyl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(CCCCOc2ccc(CCN3C[C@@H](c4ccc5c(c4)COC(C)(C)O5)OC3=O)cc2)c1 |
| InChI | InChI=1S/C33H37NO7/c1-23(35)39-29-9-6-8-25(19-29)7-4-5-18-37-28-13-10-24(11-14-28)16-17-34-21-31(40-32(34)36)26-12-15-30-27(20-26)22-38-33(2,3)41-30/h6,8-15,19-20,31H,4-5,7,16-18,21-22H2,1-3H3/t31-/m0/s1 |
| InChIKey | DKERUDYYGCHUMN-HKBQPEDESA-N |
| XLogP | 6.39 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|