C29H38N8O — CID 69396517
1-(3-tert-butyl-1-methylpyrazol-5-yl)-1-[3-[2-[2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]ethynyl]phenyl]urea (PubChem CID 69396517) has the molecular formula C29H38N8O and a molecular weight of 514.68 g/mol. Its IUPAC name is 1-(3-tert-butyl-1-methylpyrazol-5-yl)-1-[3-[2-[2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]ethynyl]phenyl]urea.
| Compound Name | 1-(3-tert-butyl-1-methylpyrazol-5-yl)-1-[3-[2-[2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]ethynyl]phenyl]urea |
|---|---|
| PubChem CID | 69396517 |
| Molecular Formula | C29H38N8O |
| Molecular Weight | 514.68 g/mol |
| Exact Mass | 514.32 |
| IUPAC Name | 1-(3-tert-butyl-1-methylpyrazol-5-yl)-1-[3-[2-[2-(3-piperidin-1-ylpropylamino)pyrimidin-5-yl]ethynyl]phenyl]urea |
| SMILES | Cn1nc(C(C)(C)C)cc1N(C(N)=O)c1cccc(C#Cc2cnc(NCCCN3CCCCC3)nc2)c1 |
| InChI | InChI=1S/C29H38N8O/c1-29(2,3)25-19-26(35(4)34-25)37(27(30)38)24-11-8-10-22(18-24)12-13-23-20-32-28(33-21-23)31-14-9-17-36-15-6-5-7-16-36/h8,10-11,18-21H,5-7,9,14-17H2,1-4H3,(H2,30,38)(H,31,32,33) |
| InChIKey | YZUPWEHXIRVJRN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 105.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.68 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|