C19H26O2 — CID 69398815
[(8R,9S,10R,13S,14S)-10-methyl-4,7,8,9,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanediol (PubChem CID 69398815) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S)-10-methyl-4,7,8,9,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanediol.
| Compound Name | [(8R,9S,10R,13S,14S)-10-methyl-4,7,8,9,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanediol |
|---|---|
| PubChem CID | 69398815 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [(8R,9S,10R,13S,14S)-10-methyl-4,7,8,9,11,12,14,17-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanediol |
| SMILES | C[C@]12C=CCCC1=CC[C@H]1[C@@H]3C=CC[C@@]3(C(O)O)CC[C@@H]12 |
| InChI | InChI=1S/C19H26O2/c1-18-10-3-2-5-13(18)7-8-14-15(18)9-12-19(17(20)21)11-4-6-16(14)19/h3-4,6-7,10,14-17,20-21H,2,5,8-9,11-12H2,1H3/t14-,15+,16+,18+,19-/m1/s1 |
| InChIKey | WEUUJABHIPTJGV-NLPXPOPTSA-N |
| XLogP | 3.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|