C19H27NO — CID 69398822
[(8R,9S,10R,13R,14S)-17-amino-10-methyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanol (PubChem CID 69398822) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is [(8R,9S,10R,13R,14S)-17-amino-10-methyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanol.
| Compound Name | [(8R,9S,10R,13R,14S)-17-amino-10-methyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanol |
|---|---|
| PubChem CID | 69398822 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | [(8R,9S,10R,13R,14S)-17-amino-10-methyl-4,7,8,9,11,12,14,15-octahydro-3H-cyclopenta[a]phenanthren-13-yl]methanol |
| SMILES | C[C@]12C=CCCC1=CC[C@H]1[C@@H]3CC=C(N)[C@@]3(CO)CC[C@@H]12 |
| InChI | InChI=1S/C19H27NO/c1-18-10-3-2-4-13(18)5-6-14-15(18)9-11-19(12-21)16(14)7-8-17(19)20/h3,5,8,10,14-16,21H,2,4,6-7,9,11-12,20H2,1H3/t14-,15+,16+,18+,19-/m1/s1 |
| InChIKey | HIYHXVGEQJFNQN-NLPXPOPTSA-N |
| XLogP | 3.54 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|