C17H14N3O4- — CID 6940310
2-[(1-acetyl-2,3-dihydroindol-5-yl)iminomethyl]-6-nitrophenolate (PubChem CID 6940310) has the molecular formula C17H14N3O4- and a molecular weight of 324.32 g/mol. Its IUPAC name is 2-[(1-acetyl-2,3-dihydroindol-5-yl)iminomethyl]-6-nitrophenolate.
| Compound Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)iminomethyl]-6-nitrophenolate |
|---|---|
| PubChem CID | 6940310 |
| Molecular Formula | C17H14N3O4- |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[(1-acetyl-2,3-dihydroindol-5-yl)iminomethyl]-6-nitrophenolate |
| SMILES | CC(=O)N1CCc2cc(/N=C/c3cccc([N+](=O)[O-])c3[O-])ccc21 |
| InChI | InChI=1S/C17H15N3O4/c1-11(21)19-8-7-12-9-14(5-6-15(12)19)18-10-13-3-2-4-16(17(13)22)20(23)24/h2-6,9-10,22H,7-8H2,1H3/p-1/b18-10+ |
| InChIKey | FMULROAXWHXILT-VCHYOVAHSA-M |
| XLogP | 2.33 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|