C38H34ClF3N2O2 — CID 69414145
N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]benzamide (PubChem CID 69414145) has the molecular formula C38H34ClF3N2O2 and a molecular weight of 643.15 g/mol. Its IUPAC name is N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]benzamide.
| Compound Name | N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 69414145 |
| Molecular Formula | C38H34ClF3N2O2 |
| Molecular Weight | 643.15 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | N-[3-[3-[[2-chloro-3-(trifluoromethyl)phenyl]methyl-(1,1-diphenylethyl)amino]propoxy]phenyl]benzamide |
| SMILES | CC(c1ccccc1)(c1ccccc1)N(CCCOc1cccc(NC(=O)c2ccccc2)c1)Cc1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C38H34ClF3N2O2/c1-37(30-17-7-3-8-18-30,31-19-9-4-10-20-31)44(27-29-16-11-23-34(35(29)39)38(40,41)42)24-13-25-46-33-22-12-21-32(26-33)43-36(45)28-14-5-2-6-15-28/h2-12,14-23,26H,13,24-25,27H2,1H3,(H,43,45) |
| InChIKey | QIPJNNPVWDESFI-UHFFFAOYSA-N |
| XLogP | 9.85 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.15 |
| LogP ≤ 5 | 9.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|