C28H35N7O4 — CID 69416695
benzyl N-[[[[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]carbamoylamino]methylidene]carbamate (PubChem CID 69416695) has the molecular formula C28H35N7O4 and a molecular weight of 533.63 g/mol. Its IUPAC name is benzyl N-[[[[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]carbamoylamino]methylidene]carbamate.
| Compound Name | benzyl N-[[[[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]carbamoylamino]methylidene]carbamate |
|---|---|
| PubChem CID | 69416695 |
| Molecular Formula | C28H35N7O4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | benzyl N-[[[[1-[(1-benzyl-3-cyanopyrrolidin-3-yl)amino]-4-methyl-1-oxopentan-2-yl]amino]carbamoylamino]methylidene]carbamate |
| SMILES | CC(C)CC(NNC(=O)NC=NC(=O)OCc1ccccc1)C(=O)NC1(C#N)CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C28H35N7O4/c1-21(2)15-24(33-34-26(37)30-20-31-27(38)39-17-23-11-7-4-8-12-23)25(36)32-28(18-29)13-14-35(19-28)16-22-9-5-3-6-10-22/h3-12,20-21,24,33H,13-17,19H2,1-2H3,(H,32,36)(H2,30,31,34,37,38) |
| InChIKey | ADKDXXSFBYGZTA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|