C25H22N4O4 — CID 69431335
4-(3-methoxyanilino)-2-(3-methoxyphenyl)quinoline-3,6-dicarboxamide (PubChem CID 69431335) has the molecular formula C25H22N4O4 and a molecular weight of 442.48 g/mol. Its IUPAC name is 4-(3-methoxyanilino)-2-(3-methoxyphenyl)quinoline-3,6-dicarboxamide.
| Compound Name | 4-(3-methoxyanilino)-2-(3-methoxyphenyl)quinoline-3,6-dicarboxamide |
|---|---|
| PubChem CID | 69431335 |
| Molecular Formula | C25H22N4O4 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 4-(3-methoxyanilino)-2-(3-methoxyphenyl)quinoline-3,6-dicarboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)c(-c3cccc(OC)c3)nc3ccc(C(N)=O)cc23)c1 |
| InChI | InChI=1S/C25H22N4O4/c1-32-17-7-3-5-14(11-17)22-21(25(27)31)23(28-16-6-4-8-18(13-16)33-2)19-12-15(24(26)30)9-10-20(19)29-22/h3-13H,1-2H3,(H2,26,30)(H2,27,31)(H,28,29) |
| InChIKey | ZZLOVFJTANOXLE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |