C25H19N5O3S — CID 69429525
2-(1,3-benzothiazol-6-yl)-4-(3-methoxyanilino)quinoline-3,6-dicarboxamide (PubChem CID 69429525) has the molecular formula C25H19N5O3S and a molecular weight of 469.53 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-6-yl)-4-(3-methoxyanilino)quinoline-3,6-dicarboxamide.
| Compound Name | 2-(1,3-benzothiazol-6-yl)-4-(3-methoxyanilino)quinoline-3,6-dicarboxamide |
|---|---|
| PubChem CID | 69429525 |
| Molecular Formula | C25H19N5O3S |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 2-(1,3-benzothiazol-6-yl)-4-(3-methoxyanilino)quinoline-3,6-dicarboxamide |
| SMILES | COc1cccc(Nc2c(C(N)=O)c(-c3ccc4ncsc4c3)nc3ccc(C(N)=O)cc23)c1 |
| InChI | InChI=1S/C25H19N5O3S/c1-33-16-4-2-3-15(11-16)29-23-17-9-14(24(26)31)6-7-18(17)30-22(21(23)25(27)32)13-5-8-19-20(10-13)34-12-28-19/h2-12H,1H3,(H2,26,31)(H2,27,32)(H,29,30) |
| InChIKey | JWKHBLWFVGLLQC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |