About 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride
1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride (PubChem CID 69434311) has the molecular formula C16H18ClN3O2
and a molecular weight of 319.79 g/mol. Its IUPAC name is 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride.
Molecular Properties
| Compound Name | 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride |
| PubChem CID | 69434311 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(c1ncc(-c2ccccc2)o1)N1CCN2CCC1C2 |
| InChI | InChI=1S/C16H17N3O2.ClH/c20-16(19-9-8-18-7-6-13(19)11-18)15-17-10-14(21-15)12-4-2-1-3-5-12;/h1-5,10,13H,6-9,11H2;1H |
| InChIKey | ZLSKRDYRWRJPKZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride?
The IUPAC name of 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride (CID 69434311) is 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride.
What is the SMILES notation for 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride?
The canonical SMILES for 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride is Cl.O=C(c1ncc(-c2ccccc2)o1)N1CCN2CCC1C2.
What is the InChIKey of 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride?
The InChIKey is ZLSKRDYRWRJPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2.ClH/c20-16(19-9-8-18-7-6-13(19)11-18)15-17-10-14(21-15)12-4-2-1-3-5-12;/h1-5,10,13H,6-9,11H2;1H.
What are the key properties of 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride?
1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride has a molecular weight of 319.79 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-diazabicyclo[3.2.1]octan-4-yl-(5-phenyl-1,3-oxazol-2-yl)methanone;hydrochloride is sourced from PubChem (CID 69434311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).