C24H45N3O — CID 69435788
(2R,3S)-3-amino-1-[5-(heptan-4-ylamino)heptylamino]-4-phenylbutan-2-ol (PubChem CID 69435788) has the molecular formula C24H45N3O and a molecular weight of 391.64 g/mol. Its IUPAC name is (2R,3S)-3-amino-1-[5-(heptan-4-ylamino)heptylamino]-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-amino-1-[5-(heptan-4-ylamino)heptylamino]-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 69435788 |
| Molecular Formula | C24H45N3O |
| Molecular Weight | 391.64 g/mol |
| Exact Mass | 391.36 |
| IUPAC Name | (2R,3S)-3-amino-1-[5-(heptan-4-ylamino)heptylamino]-4-phenylbutan-2-ol |
| SMILES | CCCC(CCC)NC(CC)CCCCNC[C@@H](O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C24H45N3O/c1-4-12-22(13-5-2)27-21(6-3)16-10-11-17-26-19-24(28)23(25)18-20-14-8-7-9-15-20/h7-9,14-15,21-24,26-28H,4-6,10-13,16-19,25H2,1-3H3/t21?,23-,24+/m0/s1 |
| InChIKey | QRIXBDLZJUOATD-RPFBHVFUSA-N |
| XLogP | 4.01 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.64 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|