C29H28ClFN2O — CID 69436009
4-[(2R,7S)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one (PubChem CID 69436009) has the molecular formula C29H28ClFN2O and a molecular weight of 475.01 g/mol. Its IUPAC name is 4-[(2R,7S)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one.
| Compound Name | 4-[(2R,7S)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 69436009 |
| Molecular Formula | C29H28ClFN2O |
| Molecular Weight | 475.01 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 4-[(2R,7S)-13-(2-chlorophenyl)-4,8-diazatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),11(15),12-trien-4-yl]-1-(4-fluorophenyl)butan-1-one |
| SMILES | O=C(CCCN1CC[C@H]2[C@@H](C1)c1cc(-c3ccccc3Cl)cc3c1N2CC3)c1ccc(F)cc1 |
| InChI | InChI=1S/C29H28ClFN2O/c30-26-5-2-1-4-23(26)21-16-20-11-15-33-27-12-14-32(18-25(27)24(17-21)29(20)33)13-3-6-28(34)19-7-9-22(31)10-8-19/h1-2,4-5,7-10,16-17,25,27H,3,6,11-15,18H2/t25-,27-/m0/s1 |
| InChIKey | QPOLSBQBNCEKTO-BDYUSTAISA-N |
| XLogP | 6.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.01 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |