C12H6Cl2CuN2O — CID 69447685
copper;3,4-dichloro-1H-1,10-phenanthrolin-2-one (PubChem CID 69447685) has the molecular formula C12H6Cl2CuN2O and a molecular weight of 328.65 g/mol. Its IUPAC name is copper;3,4-dichloro-1H-1,10-phenanthrolin-2-one.
| Compound Name | copper;3,4-dichloro-1H-1,10-phenanthrolin-2-one |
|---|---|
| PubChem CID | 69447685 |
| Molecular Formula | C12H6Cl2CuN2O |
| Molecular Weight | 328.65 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | copper;3,4-dichloro-1H-1,10-phenanthrolin-2-one |
| SMILES | O=c1[nH]c2c(ccc3cccnc32)c(Cl)c1Cl.[Cu] |
| InChI | InChI=1S/C12H6Cl2N2O.Cu/c13-8-7-4-3-6-2-1-5-15-10(6)11(7)16-12(17)9(8)14;/h1-5H,(H,16,17); |
| InChIKey | VYUMBUKLCTZWMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|