C16H16NO4S- — CID 6945027
2-(butanoylamino)-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 6945027) has the molecular formula C16H16NO4S- and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-(butanoylamino)-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | 2-(butanoylamino)-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6945027 |
| Molecular Formula | C16H16NO4S- |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-(butanoylamino)-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCCC(=O)Nc1scc(-c2ccc(OC)cc2)c1C(=O)[O-] |
| InChI | InChI=1S/C16H17NO4S/c1-3-4-13(18)17-15-14(16(19)20)12(9-22-15)10-5-7-11(21-2)8-6-10/h5-9H,3-4H2,1-2H3,(H,17,18)(H,19,20)/p-1 |
| InChIKey | UZWSLDAWYLKPKW-UHFFFAOYSA-M |
| XLogP | 2.53 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|