C14H26Cl2N2 — CID 69455480
4-ethyl-1-phenylhexane-1,4-diamine;dihydrochloride (PubChem CID 69455480) has the molecular formula C14H26Cl2N2 and a molecular weight of 293.28 g/mol. Its IUPAC name is 4-ethyl-1-phenylhexane-1,4-diamine;dihydrochloride.
| Compound Name | 4-ethyl-1-phenylhexane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 69455480 |
| Molecular Formula | C14H26Cl2N2 |
| Molecular Weight | 293.28 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-ethyl-1-phenylhexane-1,4-diamine;dihydrochloride |
| SMILES | CCC(N)(CC)CCC(N)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C14H24N2.2ClH/c1-3-14(16,4-2)11-10-13(15)12-8-6-5-7-9-12;;/h5-9,13H,3-4,10-11,15-16H2,1-2H3;2*1H |
| InChIKey | YANHJLKUSVYSET-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.28 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |