C14H13O3- — CID 6946030
(1R,6S)-6-benzoylcyclohex-3-ene-1-carboxylate (PubChem CID 6946030) has the molecular formula C14H13O3- and a molecular weight of 229.26 g/mol. Its IUPAC name is (1R,6S)-6-benzoylcyclohex-3-ene-1-carboxylate.
| Compound Name | (1R,6S)-6-benzoylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 6946030 |
| Molecular Formula | C14H13O3- |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (1R,6S)-6-benzoylcyclohex-3-ene-1-carboxylate |
| SMILES | O=C(c1ccccc1)[C@H]1CC=CC[C@H]1C(=O)[O-] |
| InChI | InChI=1S/C14H14O3/c15-13(10-6-2-1-3-7-10)11-8-4-5-9-12(11)14(16)17/h1-7,11-12H,8-9H2,(H,16,17)/p-1/t11-,12+/m0/s1 |
| InChIKey | JJALHZDTTJJYCI-NWDGAFQWSA-M |
| XLogP | 1.20 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|