C23H17F4N5O — CID 69464242
1-[4-(2-aminoquinazolin-6-yl)-3-methylphenyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 69464242) has the molecular formula C23H17F4N5O and a molecular weight of 455.42 g/mol. Its IUPAC name is 1-[4-(2-aminoquinazolin-6-yl)-3-methylphenyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[4-(2-aminoquinazolin-6-yl)-3-methylphenyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 69464242 |
| Molecular Formula | C23H17F4N5O |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 455.14 |
| IUPAC Name | 1-[4-(2-aminoquinazolin-6-yl)-3-methylphenyl]-1-[3-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(N(C(N)=O)c2cc(F)cc(C(F)(F)F)c2)ccc1-c1ccc2nc(N)ncc2c1 |
| InChI | InChI=1S/C23H17F4N5O/c1-12-6-17(32(22(29)33)18-9-15(23(25,26)27)8-16(24)10-18)3-4-19(12)13-2-5-20-14(7-13)11-30-21(28)31-20/h2-11H,1H3,(H2,29,33)(H2,28,30,31) |
| InChIKey | SGIJVFRXUDZHCU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |