C19H20N6O3S — CID 69466843
(2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(1,3-thiazol-2-yl)ethynyl]oxolane-3,4-diol (PubChem CID 69466843) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(1,3-thiazol-2-yl)ethynyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(1,3-thiazol-2-yl)ethynyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 69466843 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(cyclopentylamino)purin-9-yl]-5-[2-(1,3-thiazol-2-yl)ethynyl]oxolane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](C#Cc2nccs2)O[C@H]1n1cnc2c(NC3CCCC3)ncnc21 |
| InChI | InChI=1S/C19H20N6O3S/c26-15-12(5-6-13-20-7-8-29-13)28-19(16(15)27)25-10-23-14-17(21-9-22-18(14)25)24-11-3-1-2-4-11/h7-12,15-16,19,26-27H,1-4H2,(H,21,22,24)/t12-,15-,16-,19-/m1/s1 |
| InChIKey | XCYDCYFYNDDUGO-BGIGGGFGSA-N |
| XLogP | 1.31 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|