C11H15N3OS — CID 69468691
7-N-(2-ethoxyethyl)-1,3-benzothiazole-4,7-diamine (PubChem CID 69468691) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 7-N-(2-ethoxyethyl)-1,3-benzothiazole-4,7-diamine.
| Compound Name | 7-N-(2-ethoxyethyl)-1,3-benzothiazole-4,7-diamine |
|---|---|
| PubChem CID | 69468691 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 7-N-(2-ethoxyethyl)-1,3-benzothiazole-4,7-diamine |
| SMILES | CCOCCNc1ccc(N)c2ncsc12 |
| InChI | InChI=1S/C11H15N3OS/c1-2-15-6-5-13-9-4-3-8(12)10-11(9)16-7-14-10/h3-4,7,13H,2,5-6,12H2,1H3 |
| InChIKey | GBTKUWVTWDACOV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|