C18H19NO5 — CID 69480127
prop-2-enyl 2-acetyl-5-(1,3-dioxoisoindol-2-yl)pentanoate (PubChem CID 69480127) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is prop-2-enyl 2-acetyl-5-(1,3-dioxoisoindol-2-yl)pentanoate.
| Compound Name | prop-2-enyl 2-acetyl-5-(1,3-dioxoisoindol-2-yl)pentanoate |
|---|---|
| PubChem CID | 69480127 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | prop-2-enyl 2-acetyl-5-(1,3-dioxoisoindol-2-yl)pentanoate |
| SMILES | C=CCOC(=O)C(CCCN1C(=O)c2ccccc2C1=O)C(C)=O |
| InChI | InChI=1S/C18H19NO5/c1-3-11-24-18(23)13(12(2)20)9-6-10-19-16(21)14-7-4-5-8-15(14)17(19)22/h3-5,7-8,13H,1,6,9-11H2,2H3 |
| InChIKey | KYQDDVBDQRBPJN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|